CAS 127425-74-5 appears in our catalog under these names: 5-Bromo-4-fluoro-2,3-dihydro-1H-inden-1-one, 5-Bromo-4-fluoro-2,3-dihydro-1H-inden-1-one, 98%, 98%, 5-Bromo-4-fluoro-2,3-dihydro-1H-inden-1-one, 96%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
5-bromo-4-fluoro-2,3-dihydroinden-1-one (CAS 127425-74-5) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 5-bromo-4-fluoro-2,3-dihydroinden-1-one. InChIKey: CILPXFZGSHPJOA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 5-bromo-4-fluoro-2,3-dihydroinden-1-one |
| InChIKey | CILPXFZGSHPJOA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)Br)F |
Computed by PubChem (NCBI)