CAS 128-95-0 appears in our catalog under these names: 1,4-Diaminoanthraquinone, 95%, 1,4-Diaminoanthraquinone, Disperse Violet 1, 1,4–Diaminoanthraquinone, 1,4-Diaminoanthraquinone, >97.0%(N). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: 100g, 5g, 25g, 1g, 2,5g, 500g, 100mg, 250g.
1,4-diaminoanthracene-9,10-dione (CAS 128-95-0) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 1,4-diaminoanthracene-9,10-dione. InChIKey: FBMQNRKSAWNXBT-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 1,4-diaminoanthracene-9,10-dione |
| InChIKey | FBMQNRKSAWNXBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C=CC(=C3C2=O)N)N |
Computed by PubChem (NCBI)