Products 2757730-30-4
CAS 2757730-30-4 is the registry number for 3-(4-Amino-2-nitrophenyl)propanoic acid hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
3-(4-amino-2-nitrophenyl)propanoic acid;hydrochloride (CAS 2757730-30-4) is a chemical compound with the molecular formula C9H11ClN2O4 and a molecular weight of 246.65 g/mol. IUPAC name: 3-(4-amino-2-nitrophenyl)propanoic acid;hydrochloride. InChIKey: YKYYUGCCSFQRRV-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O4 |
|---|---|
| Molecular weight | 246.65 g/mol |
| IUPAC name | 3-(4-amino-2-nitrophenyl)propanoic acid;hydrochloride |
| InChIKey | YKYYUGCCSFQRRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])CCC(=O)O.Cl |
Computed by PubChem (NCBI)