CAS 1286330-19-5 appears in our catalog under these names: Methyl 2,4-dichloroquinazoline-8-carboxylate, 95+%, 95+%, Methyl 2,4-dichloroquinazoline-8-carboxylate, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 1g.
Methyl 2,4-dichloroquinazoline-8-carboxylate (CAS 1286330-19-5) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: methyl 2,4-dichloroquinazoline-8-carboxylate. InChIKey: XPGUIQWGORMRRW-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | methyl 2,4-dichloroquinazoline-8-carboxylate |
| InChIKey | XPGUIQWGORMRRW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC2=C1N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)