Products 1289106-07-5
CAS 1289106-07-5 appears in our catalog under these names: 2-Chloro-3-formylbenzoic acid, 97%, 2-Chloro-3-formylbenzoic acid, 2-Chloro-3-formylbenzoic acid, ≥95%, ≥95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 0,5g, 50mg, 1g.
2-chloro-3-formylbenzoic acid (CAS 1289106-07-5) is a chemical compound with the molecular formula C8H5ClO3 and a molecular weight of 184.57 g/mol. IUPAC name: 2-chloro-3-formylbenzoic acid. InChIKey: JXFUQVJNPIAUTP-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3 |
|---|---|
| Molecular weight | 184.57 g/mol |
| IUPAC name | 2-chloro-3-formylbenzoic acid |
| InChIKey | JXFUQVJNPIAUTP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)Cl)C=O |
Computed by PubChem (NCBI)