Products 1289170-62-2

CAS 1289170-62-2 is the registry number for 3-Formyl-2-methoxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-formyl-2-methoxybenzoic acid (CAS 1289170-62-2) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 3-formyl-2-methoxybenzoic acid. InChIKey: YBSAMWVRKAEQLT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8O4
Molecular weight180.16 g/mol
IUPAC name3-formyl-2-methoxybenzoic acid
InChIKeyYBSAMWVRKAEQLT-UHFFFAOYSA-N
SMILESCOC1=C(C=CC=C1C(=O)O)C=O

Computed by PubChem (NCBI)