CAS 129-44-2 appears in our catalog under these names: 1,5–Diaminoanthraquinone, 1,5-Diaminoanthraquinone, 90+% , 1,5-Diaminoanthraquinone, 1,5-Diaminoanthraquinone, >92.0%(N), 1,5-Diaminoanthraquinone 92%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 100g, 25g, 50g, 5g, 250g, 500g, 1000g, 75g.
1,5-diaminoanthracene-9,10-dione (CAS 129-44-2) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 1,5-diaminoanthracene-9,10-dione. InChIKey: VWBVCOPVKXNMMZ-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 1,5-diaminoanthracene-9,10-dione |
| InChIKey | VWBVCOPVKXNMMZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)C3=C(C2=O)C(=CC=C3)N |
Computed by PubChem (NCBI)