CAS 1290176-71-4 appears in our catalog under these names: 5,7-Dichloro-1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid, 95+%, Lifitegrast Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid (CAS 1290176-71-4) is a chemical compound with the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. IUPAC name: 5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid. InChIKey: XHRPRBRZRJWLMD-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO2 |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | 5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carboxylic acid |
| InChIKey | XHRPRBRZRJWLMD-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC(=C(C(=C21)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)