CAS 17223-66-4 is the registry number for N-(2,4-Dichlorophenyl)-3-oxobutanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
N-(2,4-dichlorophenyl)-3-oxobutanamide (CAS 17223-66-4) is a chemical compound with the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. IUPAC name: N-(2,4-dichlorophenyl)-3-oxobutanamide. InChIKey: YTKNYOWCICFXOW-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO2 |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | N-(2,4-dichlorophenyl)-3-oxobutanamide |
| InChIKey | YTKNYOWCICFXOW-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)