CAS 865658-35-1 is the registry number for 6-Chloro-2-(2-chloroethyl)-2h-1,4-benzoxazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-chloro-2-(2-chloroethyl)-4H-1,4-benzoxazin-3-one (CAS 865658-35-1) is a chemical compound with the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. IUPAC name: 6-chloro-2-(2-chloroethyl)-4H-1,4-benzoxazin-3-one. InChIKey: SHRBFRKMIRXEQN-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO2 |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | 6-chloro-2-(2-chloroethyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | SHRBFRKMIRXEQN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=O)C(O2)CCCl |
Computed by PubChem (NCBI)