Products 320416-92-0
CAS 320416-92-0 is the registry number for (3E)-1-(3,4-Dichlorophenyl)-3-(methoxyimino)propan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(3E)-1-(3,4-dichlorophenyl)-3-methoxyiminopropan-1-one (CAS 320416-92-0) is a chemical compound with the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. IUPAC name: (3E)-1-(3,4-dichlorophenyl)-3-methoxyiminopropan-1-one. InChIKey: FCASRJOSKITIFV-WLRTZDKTSA-N.
| Molecular formula | C10H9Cl2NO2 |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | (3E)-1-(3,4-dichlorophenyl)-3-methoxyiminopropan-1-one |
| InChIKey | FCASRJOSKITIFV-WLRTZDKTSA-N |
| SMILES | CO/N=C/CC(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)