Products 2107245-73-6

CAS 2107245-73-6 is the registry number for 5,8-Dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5,8-dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CAS 2107245-73-6) is a chemical compound with the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. IUPAC name: 5,8-dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid. InChIKey: FHNANMMPOPGGRD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9Cl2NO2
Molecular weight246.09 g/mol
IUPAC name5,8-dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid
InChIKeyFHNANMMPOPGGRD-UHFFFAOYSA-N
SMILESC1CNC2=C(C=CC(=C2C1C(=O)O)Cl)Cl

Computed by PubChem (NCBI)