CAS 2107245-73-6 is the registry number for 5,8-Dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,8-dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CAS 2107245-73-6) is a chemical compound with the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. IUPAC name: 5,8-dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid. InChIKey: FHNANMMPOPGGRD-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO2 |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | 5,8-dichloro-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| InChIKey | FHNANMMPOPGGRD-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C=CC(=C2C1C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)