Products 90798-25-7
CAS 90798-25-7 is the registry number for Diclofenac Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-[4-(2-chloroacetyl)phenyl]acetamide (CAS 90798-25-7) is a chemical compound with the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. IUPAC name: 2-chloro-N-[4-(2-chloroacetyl)phenyl]acetamide. InChIKey: UZWBXXGVAVFRGA-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO2 |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | 2-chloro-N-[4-(2-chloroacetyl)phenyl]acetamide |
| InChIKey | UZWBXXGVAVFRGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CCl)NC(=O)CCl |
Computed by PubChem (NCBI)