CAS 1616289-16-7 is the registry number for 5,8-Dichloro-7-methoxy-3,4-dihydroisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,8-dichloro-7-methoxy-3,4-dihydro-2H-isoquinolin-1-one (CAS 1616289-16-7) is a chemical compound with the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. IUPAC name: 5,8-dichloro-7-methoxy-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: TYLYIHPCZPVFIA-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO2 |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | 5,8-dichloro-7-methoxy-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | TYLYIHPCZPVFIA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2CCNC(=O)C2=C1Cl)Cl |
Computed by PubChem (NCBI)