CAS 1892523-55-5 is the registry number for 6,8-Dichloro-2-ethyl-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-2-ethyl-4H-1,4-benzoxazin-3-one (CAS 1892523-55-5) is a chemical compound with the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. IUPAC name: 6,8-dichloro-2-ethyl-4H-1,4-benzoxazin-3-one. InChIKey: JVGNFDNZPLPQRM-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO2 |
|---|---|
| Molecular weight | 246.09 g/mol |
| IUPAC name | 6,8-dichloro-2-ethyl-4H-1,4-benzoxazin-3-one |
| InChIKey | JVGNFDNZPLPQRM-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)NC2=C(O1)C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)