CAS 1291493-41-8 is the registry number for 3-(Ethoxymethyl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(ethoxymethyl)benzenesulfonyl chloride (CAS 1291493-41-8) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 3-(ethoxymethyl)benzenesulfonyl chloride. InChIKey: LZBJJNKGUOZJLT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 3-(ethoxymethyl)benzenesulfonyl chloride |
| InChIKey | LZBJJNKGUOZJLT-UHFFFAOYSA-N |
| SMILES | CCOCC1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)