Products 129589-63-5
CAS 129589-63-5 is the registry number for Ethyl 3-(3-{[(tert-Butoxy)carbonyl]amino}phenyl)-3-oxopropanoate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2,6-difluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (CAS 129589-63-5) is a chemical compound with the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. IUPAC name: methyl 2,6-difluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate. InChIKey: MOSKUVOXKDZQDD-UHFFFAOYSA-N.
| Molecular formula | C13H15F2NO4 |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | methyl 2,6-difluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate |
| InChIKey | MOSKUVOXKDZQDD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C(=C1)F)C(=O)OC)F |
Computed by PubChem (NCBI)