CAS 1296272-87-1 is the registry number for 3-(2-Hydroxyphenyl)-1h-pyrazole-5-carboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-(2-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid;hydrate (CAS 1296272-87-1) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 3-(2-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid;hydrate. InChIKey: FYPAKDCEIDGXLB-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 3-(2-hydroxyphenyl)-1H-pyrazole-5-carboxylic acid;hydrate |
| InChIKey | FYPAKDCEIDGXLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=C2)C(=O)O)O.O |
Computed by PubChem (NCBI)