Products 29451-88-5
CAS 29451-88-5 is the registry number for 5-Oxo-1-(2-phenylethyl)pyrrolidine-3-carbonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-oxo-1-(2-phenylethyl)pyrrolidine-3-carbonyl chloride (CAS 29451-88-5) is a chemical compound with the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. IUPAC name: 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carbonyl chloride. InChIKey: IQEQMBNXMBVLTQ-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO2 |
|---|---|
| Molecular weight | 251.71 g/mol |
| IUPAC name | 5-oxo-1-(2-phenylethyl)pyrrolidine-3-carbonyl chloride |
| InChIKey | IQEQMBNXMBVLTQ-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CCC2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)