CAS 13030-09-6 appears in our catalog under these names: H–Glu–OBzl, H-L-Glu-OBzl, 1-Benzyl L-Glutamate, >98.0%(HPLC)(T), L-Glutamic acid α-benzyl ester, 98%, 98%, H-Glu-Obzl, 99.78%. Offered by: GLPBio, Iris Biotech, TCI, Chemat, MedChemExpress. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 250mg, 100 g, 10 g.
(4S)-4-amino-5-oxo-5-phenylmethoxypentanoic acid (CAS 13030-09-6) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (4S)-4-amino-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: HFZKKJHBHCZXTQ-JTQLQIEISA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (4S)-4-amino-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | HFZKKJHBHCZXTQ-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CCC(=O)O)N |
Computed by PubChem (NCBI)