CAS 79338-14-0 appears in our catalog under these names: H–D–Glu–OBzl, 1-Benzyl D-Glutamate, >98.0%(HPLC)(T), H-D-Glu-OBzl 97%, H-D-Glu-OBzl, 97%, 97%, h-d-glu-obzl, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g.
(4R)-4-amino-5-oxo-5-phenylmethoxypentanoic acid (CAS 79338-14-0) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (4R)-4-amino-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: HFZKKJHBHCZXTQ-SNVBAGLBSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (4R)-4-amino-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | HFZKKJHBHCZXTQ-SNVBAGLBSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@@H](CCC(=O)O)N |
Computed by PubChem (NCBI)