CAS 1303530-45-1 appears in our catalog under these names: (S)-Ethyl 2-amino-2-(4-chlorophenyl)acetate hydrochloride, 97%, ethyl (2S)-2-amino-2-(4-chlorophenyl)acetate hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Ethyl (2S)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride (CAS 1303530-45-1) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: ethyl (2S)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride. InChIKey: LRTVYMMSQHSIIN-FVGYRXGTSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | ethyl (2S)-2-amino-2-(4-chlorophenyl)acetate;hydrochloride |
| InChIKey | LRTVYMMSQHSIIN-FVGYRXGTSA-N |
| SMILES | CCOC(=O)[C@H](C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)