CAS 130365-87-6 appears in our catalog under these names: 4–(Trifluoromethyl)phenethyl bromide, 1-(2-Bromoethyl)-4-(trifluoromethyl)benzene 95%, 4-(TRIFLUOROMETHYL)PHENETHYL BROMIDE, 1-(2-Bromoethyl)-4-(trifluoromethyl)benzene, 95%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
1-(2-bromoethyl)-4-(trifluoromethyl)benzene (CAS 130365-87-6) is a chemical compound with the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. IUPAC name: 1-(2-bromoethyl)-4-(trifluoromethyl)benzene. InChIKey: WTCVMJLGKMOROW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | 1-(2-bromoethyl)-4-(trifluoromethyl)benzene |
| InChIKey | WTCVMJLGKMOROW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCBr)C(F)(F)F |
Computed by PubChem (NCBI)