CAS 1309982-19-1 appears in our catalog under these names: (1,3-Dimethyl-1H-indazol-7-yl)boronic acid 98+%, 1,3-DIMETHYL-1H-INDAZOLE-7-BORONIC ACID, 98+%, 98+%, 1,3-DIMETHYL-1H-INDAZOLE-7-BORONIC ACID, 98+%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1,3-dimethylindazol-7-yl)boronic acid (CAS 1309982-19-1) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 190.01 g/mol. IUPAC name: (1,3-dimethylindazol-7-yl)boronic acid. InChIKey: FNYYEXREWPLXSW-UHFFFAOYSA-N.
| Molecular formula | C9H11BN2O2 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (1,3-dimethylindazol-7-yl)boronic acid |
| InChIKey | FNYYEXREWPLXSW-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C(=NN2C)C)(O)O |
Computed by PubChem (NCBI)