CAS 1314777-15-5 appears in our catalog under these names: Imidazo[1,2-a]pyridine-6-carboxylic acid hydrochloride, 95%, Imidazo(1,2-a)pyridine-6-carboxylic acid hydrochloride, 98+%, Imidazo(1,2-a)pyridine-6-carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 25g, 2,5g, 0,25g.
Imidazo[1,2-a]pyridine-6-carboxylic acid;hydrochloride (CAS 1314777-15-5) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: imidazo[1,2-a]pyridine-6-carboxylic acid;hydrochloride. InChIKey: GIDMXSYORNNELW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | imidazo[1,2-a]pyridine-6-carboxylic acid;hydrochloride |
| InChIKey | GIDMXSYORNNELW-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CN2C=C1C(=O)O.Cl |
Computed by PubChem (NCBI)