CAS 1318629-63-8 appears in our catalog under these names: 7-Phenylpyrrolo(2,1-f)(1,2,4)triazin-2-ol, 97%, 7–Phenylpyrrolo(2,1–f)(1,2,4)triazin–2–ol. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg.
7-phenyl-1H-pyrrolo[2,1-f][1,2,4]triazin-2-one (CAS 1318629-63-8) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 7-phenyl-1H-pyrrolo[2,1-f][1,2,4]triazin-2-one. InChIKey: FRBNBMUFXLIODE-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 7-phenyl-1H-pyrrolo[2,1-f][1,2,4]triazin-2-one |
| InChIKey | FRBNBMUFXLIODE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C3N2NC(=O)N=C3 |
Computed by PubChem (NCBI)