CAS 1324054-59-2 is the registry number for METHYL 3-FLUORO-4-(METHOXYCARBONYL)BENZENEACETATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
Methyl 2-fluoro-4-(2-methoxy-2-oxoethyl)benzoate (CAS 1324054-59-2) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: methyl 2-fluoro-4-(2-methoxy-2-oxoethyl)benzoate. InChIKey: DSOJLLUVRGVPMR-UHFFFAOYSA-N.
| Molecular formula | C11H11FO4 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | methyl 2-fluoro-4-(2-methoxy-2-oxoethyl)benzoate |
| InChIKey | DSOJLLUVRGVPMR-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1)C(=O)OC)F |
Computed by PubChem (NCBI)