Products 13282-09-2

CAS 13282-09-2 is the registry number for 1,4-Bis(4-carboxyphenoxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[4-(4-carboxyphenoxy)phenoxy]benzoic acid (CAS 13282-09-2) is a chemical compound with the molecular formula C20H14O6 and a molecular weight of 350.3 g/mol. IUPAC name: 4-[4-(4-carboxyphenoxy)phenoxy]benzoic acid. InChIKey: QVLMBWTVLGOLHI-UHFFFAOYSA-N.

Identity
Molecular formulaC20H14O6
Molecular weight350.3 g/mol
IUPAC name4-[4-(4-carboxyphenoxy)phenoxy]benzoic acid
InChIKeyQVLMBWTVLGOLHI-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)OC3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)