CAS 1656308-56-3 appears in our catalog under these names: 2',5'–Dihydroxy–(1,1':4',1'–terphenyl)–4,4'–dicarboxylic acid, 2',5'-Dihydroxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 97%, 97%, 2',5'-Dihydroxy-[1,1':4',1"-terphenyl]-4,4"-dicarboxylic acid, 97%, 2',5'-Dihydroxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-[4-(4-carboxyphenyl)-2,5-dihydroxyphenyl]benzoic acid (CAS 1656308-56-3) is a chemical compound with the molecular formula C20H14O6 and a molecular weight of 350.3 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-2,5-dihydroxyphenyl]benzoic acid. InChIKey: GFNWNPNNRFSOOV-UHFFFAOYSA-N.
| Molecular formula | C20H14O6 |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)-2,5-dihydroxyphenyl]benzoic acid |
| InChIKey | GFNWNPNNRFSOOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2O)C3=CC=C(C=C3)C(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)