CAS 2243651-18-3 appears in our catalog under these names: 3,3''–Dihydroxy–(1,1':4',1''–terphenyl)–4,4''–dicarboxylic acid, 3,3''-Dihydroxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 95%, 95%, 3,3''-Dihydroxy-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-[4-(4-carboxy-3-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid (CAS 2243651-18-3) is a chemical compound with the molecular formula C20H14O6 and a molecular weight of 350.3 g/mol. IUPAC name: 4-[4-(4-carboxy-3-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid. InChIKey: BMJACGQXGAMSIK-UHFFFAOYSA-N.
| Molecular formula | C20H14O6 |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 4-[4-(4-carboxy-3-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid |
| InChIKey | BMJACGQXGAMSIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)C(=O)O)O)C3=CC(=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)