Products 77865-43-1
CAS 77865-43-1 is the registry number for 4,4'-(1,3-Phenylenebis(oxy))dibenzoic acid, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg.
4-[3-(4-carboxyphenoxy)phenoxy]benzoic acid (CAS 77865-43-1) is a chemical compound with the molecular formula C20H14O6 and a molecular weight of 350.3 g/mol. IUPAC name: 4-[3-(4-carboxyphenoxy)phenoxy]benzoic acid. InChIKey: RRHVBIZTCZUVAG-UHFFFAOYSA-N.
| Molecular formula | C20H14O6 |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 4-[3-(4-carboxyphenoxy)phenoxy]benzoic acid |
| InChIKey | RRHVBIZTCZUVAG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=CC=C(C=C2)C(=O)O)OC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)