CAS 79862-78-5 is the registry number for Daurinol. Offered by: TRC. Available pack sizes: 50mg.
4-(1,3-benzodioxol-5-yl)-7-hydroxy-6-methoxy-1H-benzo[f][2]benzofuran-3-one (CAS 79862-78-5) is a chemical compound with the molecular formula C20H14O6 and a molecular weight of 350.3 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yl)-7-hydroxy-6-methoxy-1H-benzo[f][2]benzofuran-3-one. InChIKey: QGNYAXUXBZUMPS-UHFFFAOYSA-N.
| Molecular formula | C20H14O6 |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-yl)-7-hydroxy-6-methoxy-1H-benzo[f][2]benzofuran-3-one |
| InChIKey | QGNYAXUXBZUMPS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C3=C(COC3=O)C=C2C=C1O)C4=CC5=C(C=C4)OCO5 |
Computed by PubChem (NCBI)