Products 216955-79-2
CAS 216955-79-2 appears in our catalog under these names: 7，7'–Dihydrotaiwanin C/(1R)–1，4–Dihydrotaiwanin C, (R)-7,7'-Dihydrotaiwanin C. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1 mg.
(5R)-5-(1,3-benzodioxol-5-yl)-8,9-dihydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one (CAS 216955-79-2) is a chemical compound with the molecular formula C20H14O6 and a molecular weight of 350.3 g/mol. IUPAC name: (5R)-5-(1,3-benzodioxol-5-yl)-8,9-dihydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one. InChIKey: DBOCPTFHTGKHEP-GOSISDBHSA-N.
| Molecular formula | C20H14O6 |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | (5R)-5-(1,3-benzodioxol-5-yl)-8,9-dihydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
| InChIKey | DBOCPTFHTGKHEP-GOSISDBHSA-N |
| SMILES | C1C2=C([C@@H](C3=CC4=C(C=C31)OCO4)C5=CC6=C(C=C5)OCO6)C(=O)OC2 |
Computed by PubChem (NCBI)