Products 3153-73-9
CAS 3153-73-9 appears in our catalog under these names: Matsukaze–lactone, Matsukaze-lactone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
7-methoxy-8-(7-methoxy-2-oxochromen-6-yl)chromen-2-one (CAS 3153-73-9) is a chemical compound with the molecular formula C20H14O6 and a molecular weight of 350.3 g/mol. IUPAC name: 7-methoxy-8-(7-methoxy-2-oxochromen-6-yl)chromen-2-one. InChIKey: NFNSSVSQSNJVCR-UHFFFAOYSA-N.
| Molecular formula | C20H14O6 |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 7-methoxy-8-(7-methoxy-2-oxochromen-6-yl)chromen-2-one |
| InChIKey | NFNSSVSQSNJVCR-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C=CC(=O)O2)C3=C(C=C4C(=C3)C=CC(=O)O4)OC |
Computed by PubChem (NCBI)