CAS 1623061-09-5 appears in our catalog under these names: 4,4''–Dihydroxy–(1,1':4',1''–terphenyl)–3,3''–dicarboxylicacid, 4,4''-Dihydroxy-[1,1':4',1''-terphenyl]-3,3''-dicarboxylic acid, 97%, 97%, 4,4''-Dihydroxy-[1,1':4',1''-terphenyl]-3,3''-dicarboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
5-[4-(3-carboxy-4-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid (CAS 1623061-09-5) is a chemical compound with the molecular formula C20H14O6 and a molecular weight of 350.3 g/mol. IUPAC name: 5-[4-(3-carboxy-4-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid. InChIKey: DBLXGWZXBPJXAK-UHFFFAOYSA-N.
| Molecular formula | C20H14O6 |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 5-[4-(3-carboxy-4-hydroxyphenyl)phenyl]-2-hydroxybenzoic acid |
| InChIKey | DBLXGWZXBPJXAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)O)C(=O)O)C3=CC(=C(C=C3)O)C(=O)O |
Computed by PubChem (NCBI)