Products 1329611-28-0
CAS 1329611-28-0 appears in our catalog under these names: Xanthurenic Acid-d4, >95% (HPLC), Xanthurenic acid–d4, Xanthurenic acid-d4, 99.09%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 500μg, 5 mg, 2.5 mg.
3,5,6,7-tetradeuterio-4,8-dihydroxyquinoline-2-carboxylic acid (CAS 1329611-28-0) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 209.19 g/mol. IUPAC name: 3,5,6,7-tetradeuterio-4,8-dihydroxyquinoline-2-carboxylic acid. InChIKey: FBZONXHGGPHHIY-RHQRLBAQSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 209.19 g/mol |
| IUPAC name | 3,5,6,7-tetradeuterio-4,8-dihydroxyquinoline-2-carboxylic acid |
| InChIKey | FBZONXHGGPHHIY-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C2=C(C(=C1[2H])O)N=C(C(=C2O)[2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)