CAS 1329835-20-2 is the registry number for 2-Methyl-3-biphenylmethanol-d5. Offered by: TRC. Available pack sizes: 10mg, 1mg.
[2-methyl-3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]methanol (CAS 1329835-20-2) is a chemical compound with the molecular formula C14H14O and a molecular weight of 203.29 g/mol. IUPAC name: [2-methyl-3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]methanol. InChIKey: BGTLHJPGBIVQLJ-QRKCWBMQSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 203.29 g/mol |
| IUPAC name | [2-methyl-3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]methanol |
| InChIKey | BGTLHJPGBIVQLJ-QRKCWBMQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC=CC(=C2C)CO)[2H])[2H] |
Computed by PubChem (NCBI)