Products 13300-61-3
CAS 13300-61-3 appears in our catalog under these names: 2,3-Dichloro-5-nitrobenzoic acid, 2,3-Dichloro-5-nitrobenzoic acid, 95+%. Offered by: Biosynth, Fluorochem, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
2,3-dichloro-5-nitrobenzoic acid (CAS 13300-61-3) is a chemical compound with the molecular formula C7H3Cl2NO4 and a molecular weight of 236.01 g/mol. IUPAC name: 2,3-dichloro-5-nitrobenzoic acid. InChIKey: ZHQQQRTYWQXNSU-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO4 |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 2,3-dichloro-5-nitrobenzoic acid |
| InChIKey | ZHQQQRTYWQXNSU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)