Products 55775-97-8
CAS 55775-97-8 appears in our catalog under these names: 2,6–Dichloro–3–nitrobenzoic acid, 2,6-Dichloro-3-nitrobenzoic Acid, >98.0%(T), 2,6-Dichloro-3-nitrobenzoic acid 98%, 2，6-Dichloro-3-nitrobenzoic acid, 98%, 98%, 2,6-Dichloro-3-nitrobenzoic acid, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 250mg, 10g.
2,6-dichloro-3-nitrobenzoic acid (CAS 55775-97-8) is a chemical compound with the molecular formula C7H3Cl2NO4 and a molecular weight of 236.01 g/mol. IUPAC name: 2,6-dichloro-3-nitrobenzoic acid. InChIKey: PCIHIUCCINHORT-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO4 |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 2,6-dichloro-3-nitrobenzoic acid |
| InChIKey | PCIHIUCCINHORT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dichloro-3-nitrobenzoic acid, InChI=1/C7H3Cl2NO4/c8-3-1-2-4(10(13)14)6(9)5(3)7(11)12/h1-2H,(H,11,12, 2,6-Dichloro-3-nitrobenzoicacid, 2,6-dichloro-3-nitro-benzoic acid, 26-Dichloro-3-nitrobenzoic acid, Benzoic acid, 2,6-dichloro-3-nitro-, 2,6-Dichloro-3-nitrobenzoic acid, 96%, 2,6-Dichloro-3-nitro benzoic acid, 5-nit, 2,6dichloro-5-nitrobenzoic acid