Products 39053-42-4

CAS 39053-42-4 appears in our catalog under these names: 2,4-Dichloro-3-nitrobenzoic acid, 95%, 2,4-Dichloro-3-nitrobenzoic acid, 98%, 98%, 2,4-DICHLORO-3-NITROBENZOIC ACID, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

2,4-dichloro-3-nitrobenzoic acid (CAS 39053-42-4) is a chemical compound with the molecular formula C7H3Cl2NO4 and a molecular weight of 236.01 g/mol. IUPAC name: 2,4-dichloro-3-nitrobenzoic acid. InChIKey: KBQPYERMRVPJDC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2NO4
Molecular weight236.01 g/mol
IUPAC name2,4-dichloro-3-nitrobenzoic acid
InChIKeyKBQPYERMRVPJDC-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C(=O)O)Cl)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)