CAS 39053-42-4 appears in our catalog under these names: 2,4-Dichloro-3-nitrobenzoic acid, 95%, 2,4-Dichloro-3-nitrobenzoic acid, 98%, 98%, 2,4-DICHLORO-3-NITROBENZOIC ACID, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
2,4-dichloro-3-nitrobenzoic acid (CAS 39053-42-4) is a chemical compound with the molecular formula C7H3Cl2NO4 and a molecular weight of 236.01 g/mol. IUPAC name: 2,4-dichloro-3-nitrobenzoic acid. InChIKey: KBQPYERMRVPJDC-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO4 |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 2,4-dichloro-3-nitrobenzoic acid |
| InChIKey | KBQPYERMRVPJDC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)