Products 13300-62-4
CAS 13300-62-4 is the registry number for 2,3-Dichloro-6-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,3-dichloro-6-nitrobenzoic acid (CAS 13300-62-4) is a chemical compound with the molecular formula C7H3Cl2NO4 and a molecular weight of 236.01 g/mol. IUPAC name: 2,3-dichloro-6-nitrobenzoic acid. InChIKey: MWFKWTVYKGMWEH-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO4 |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 2,3-dichloro-6-nitrobenzoic acid |
| InChIKey | MWFKWTVYKGMWEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)