Products 23082-45-3
CAS 23082-45-3 appears in our catalog under these names: 3,5-Dichloro-2-nitrobenzoic acid 95%, 3,5-Dichloro-2-nitrobenzoic acid, 97%, 97%, 3,5-Dichloro-2-nitrobenzoic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
3,5-dichloro-2-nitrobenzoic acid (CAS 23082-45-3) is a chemical compound with the molecular formula C7H3Cl2NO4 and a molecular weight of 236.01 g/mol. IUPAC name: 3,5-dichloro-2-nitrobenzoic acid. InChIKey: LKMJMYZOEGSMDN-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO4 |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 3,5-dichloro-2-nitrobenzoic acid |
| InChIKey | LKMJMYZOEGSMDN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)