Products 2011-09-8
CAS 2011-09-8 is the registry number for 4,5-Dichloro-2-nitrobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
4,5-dichloro-2-nitrobenzoic acid (CAS 2011-09-8) is a chemical compound with the molecular formula C7H3Cl2NO4 and a molecular weight of 236.01 g/mol. IUPAC name: 4,5-dichloro-2-nitrobenzoic acid. InChIKey: SUHYJVCHLDIPIY-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO4 |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 4,5-dichloro-2-nitrobenzoic acid |
| InChIKey | SUHYJVCHLDIPIY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)