CAS 1935433-61-6 is the registry number for 2,6–dichloropyridine–3,4–dicarboxylic acid. Offered by: GLPBio. Available pack sizes: 200mg.
2,6-dichloropyridine-3,4-dicarboxylic acid (CAS 1935433-61-6) is a chemical compound with the molecular formula C7H3Cl2NO4 and a molecular weight of 236.01 g/mol. IUPAC name: 2,6-dichloropyridine-3,4-dicarboxylic acid. InChIKey: AQJPEVDWVYVNCN-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO4 |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 2,6-dichloropyridine-3,4-dicarboxylic acid |
| InChIKey | AQJPEVDWVYVNCN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)