CAS 88-86-8 appears in our catalog under these names: 2,5-Dichloro-3-nitrobenzoic acid 95%, 2,5-Dichloro-3-nitrobenzoic acid, 95%, 95%, 2,5-Dichloro-3-nitrobenzoic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g.
2,5-dichloro-3-nitrobenzoic acid (CAS 88-86-8) is a chemical compound with the molecular formula C7H3Cl2NO4 and a molecular weight of 236.01 g/mol. IUPAC name: 2,5-dichloro-3-nitrobenzoic acid. InChIKey: AUAXYMOBWXOEQD-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NO4 |
|---|---|
| Molecular weight | 236.01 g/mol |
| IUPAC name | 2,5-dichloro-3-nitrobenzoic acid |
| InChIKey | AUAXYMOBWXOEQD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)