CAS 1334499-78-3 appears in our catalog under these names: Cis-1-tert-butyl 4-methyl 3-methylpiperidine-1,4-dicarboxylate, 95%, Cis-1-tert-butyl 4-methyl 3-methylpiperidine-1,4-dicarboxylate, 97%, 97%, CIS-N-BOC-3-METHYLPIPERIDINE-4-CARBOXYLIC ACID METHYL ESTER, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 500mg.
1-O-tert-butyl 4-O-methyl (3R,4R)-3-methylpiperidine-1,4-dicarboxylate (CAS 1334499-78-3) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (3R,4R)-3-methylpiperidine-1,4-dicarboxylate. InChIKey: ZFAWFFHKIMXTPI-VHSXEESVSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl (3R,4R)-3-methylpiperidine-1,4-dicarboxylate |
| InChIKey | ZFAWFFHKIMXTPI-VHSXEESVSA-N |
| SMILES | C[C@H]1CN(CC[C@H]1C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)