Products 2008714-59-6
CAS 2008714-59-6 is the registry number for 1,4-Piperidinedicarboxylic acid, 3-methyl-, 1-(1,1-dimethylethyl) 4-methyl ester, (3R,4S)-, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-O-tert-butyl 4-O-methyl (3R,4S)-3-methylpiperidine-1,4-dicarboxylate (CAS 2008714-59-6) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (3R,4S)-3-methylpiperidine-1,4-dicarboxylate. InChIKey: ZFAWFFHKIMXTPI-UWVGGRQHSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl (3R,4S)-3-methylpiperidine-1,4-dicarboxylate |
| InChIKey | ZFAWFFHKIMXTPI-UWVGGRQHSA-N |
| SMILES | C[C@H]1CN(CC[C@@H]1C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)