Products 2361926-69-2
CAS 2361926-69-2 is the registry number for O1-tert-butyl O4-methyl (3S,4R)-3-methylpiperidine-1,4-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-O-tert-butyl 4-O-methyl (3S,4R)-3-methylpiperidine-1,4-dicarboxylate (CAS 2361926-69-2) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (3S,4R)-3-methylpiperidine-1,4-dicarboxylate. InChIKey: ZFAWFFHKIMXTPI-NXEZZACHSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl (3S,4R)-3-methylpiperidine-1,4-dicarboxylate |
| InChIKey | ZFAWFFHKIMXTPI-NXEZZACHSA-N |
| SMILES | C[C@@H]1CN(CC[C@H]1C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)