Products 1820570-43-1

CAS 1820570-43-1 is the registry number for 1-(tert-Butyl) 4-methyl (3R,4R)-3-methylpiperidine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-methyl (3R,4R)-3-methylpiperidine-1,4-dicarboxylate (CAS 1820570-43-1) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (3R,4R)-3-methylpiperidine-1,4-dicarboxylate. InChIKey: ZFAWFFHKIMXTPI-VHSXEESVSA-N.

Identity
Molecular formulaC13H23NO4
Molecular weight257.33 g/mol
IUPAC name1-O-tert-butyl 4-O-methyl (3R,4R)-3-methylpiperidine-1,4-dicarboxylate
InChIKeyZFAWFFHKIMXTPI-VHSXEESVSA-N
SMILESC[C@H]1CN(CC[C@H]1C(=O)OC)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)