Products 1334671-66-7
CAS 1334671-66-7 is the registry number for Fmoc-cis-4-Bzl-Pro-OH 97%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
(2S,4S)-4-benzyl-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 1334671-66-7) is a chemical compound with the molecular formula C27H25NO4 and a molecular weight of 427.5 g/mol. IUPAC name: (2S,4S)-4-benzyl-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: TURIFBDQLJNYAM-DFBJGRDBSA-N.
| Molecular formula | C27H25NO4 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | (2S,4S)-4-benzyl-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | TURIFBDQLJNYAM-DFBJGRDBSA-N |
| SMILES | C1[C@@H](CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CC5=CC=CC=C5 |
Computed by PubChem (NCBI)